C22H18F3N3O — CID 170156523
4-methyl-3-(1-pyridin-3-ylaziridin-2-yl)-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 170156523) has the molecular formula C22H18F3N3O and a molecular weight of 397.40 g/mol. Its IUPAC name is 4-methyl-3-(1-pyridin-3-ylaziridin-2-yl)-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-methyl-3-(1-pyridin-3-ylaziridin-2-yl)-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 170156523 |
| Molecular Formula | C22H18F3N3O |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-methyl-3-(1-pyridin-3-ylaziridin-2-yl)-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1C1CN1c1cccnc1 |
| InChI | InChI=1S/C22H18F3N3O/c1-14-7-8-15(10-19(14)20-13-28(20)18-6-3-9-26-12-18)21(29)27-17-5-2-4-16(11-17)22(23,24)25/h2-12,20H,13H2,1H3,(H,27,29) |
| InChIKey | PSRHORFHKWCYOM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 45.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|