C12H12ClNO4S — CID 170165876
1-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride (PubChem CID 170165876) has the molecular formula C12H12ClNO4S and a molecular weight of 301.75 g/mol. Its IUPAC name is 1-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride.
| Compound Name | 1-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride |
|---|---|
| PubChem CID | 170165876 |
| Molecular Formula | C12H12ClNO4S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 1-(1,3-dioxoisoindol-2-yl)butane-2-sulfonyl chloride |
| SMILES | CCC(CN1C(=O)c2ccccc2C1=O)S(=O)(=O)Cl |
| InChI | InChI=1S/C12H12ClNO4S/c1-2-8(19(13,17)18)7-14-11(15)9-5-3-4-6-10(9)12(14)16/h3-6,8H,2,7H2,1H3 |
| InChIKey | YDTSVTXBQDILHT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|