C16H21F3N3O3+ — CID 170169762
[3-[1-[[(2R)-2-amino-4-methylpentanoyl]amino]cyclopropyl]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 170169762) has the molecular formula C16H21F3N3O3+ and a molecular weight of 360.36 g/mol. Its IUPAC name is [3-[1-[[(2R)-2-amino-4-methylpentanoyl]amino]cyclopropyl]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[1-[[(2R)-2-amino-4-methylpentanoyl]amino]cyclopropyl]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 170169762 |
| Molecular Formula | C16H21F3N3O3+ |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [3-[1-[[(2R)-2-amino-4-methylpentanoyl]amino]cyclopropyl]pyridin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)C[C@@H](N)C(=O)NC1(c2ccc[n+](OC(=O)C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H20F3N3O3/c1-10(2)8-12(20)13(23)21-15(5-6-15)11-4-3-7-22(9-11)25-14(24)16(17,18)19/h3-4,7,9-10,12H,5-6,8,20H2,1-2H3/p+1/t12-/m1/s1 |
| InChIKey | RUPNYDITKBWSTJ-GFCCVEGCSA-O |
| XLogP | 0.97 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|