About 1-ethyl-5,7-dinitroindazole
1-ethyl-5,7-dinitroindazole (PubChem CID 170170477) has the molecular formula C9H8N4O4
and a molecular weight of 236.19 g/mol. Its IUPAC name is 1-ethyl-5,7-dinitroindazole.
Molecular Properties
| Compound Name | 1-ethyl-5,7-dinitroindazole |
| PubChem CID | 170170477 |
| Molecular Formula | C9H8N4O4 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 1-ethyl-5,7-dinitroindazole |
| SMILES | CCn1ncc2cc([N+](=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C9H8N4O4/c1-2-11-9-6(5-10-11)3-7(12(14)15)4-8(9)13(16)17/h3-5H,2H2,1H3 |
| InChIKey | FPIZETJQUAGKJB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-5,7-dinitroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5,7-dinitroindazole?
The IUPAC name of 1-ethyl-5,7-dinitroindazole (CID 170170477) is 1-ethyl-5,7-dinitroindazole.
What is the SMILES notation for 1-ethyl-5,7-dinitroindazole?
The canonical SMILES for 1-ethyl-5,7-dinitroindazole is CCn1ncc2cc([N+](=O)[O-])cc([N+](=O)[O-])c21.
What is the InChIKey of 1-ethyl-5,7-dinitroindazole?
The InChIKey is FPIZETJQUAGKJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O4/c1-2-11-9-6(5-10-11)3-7(12(14)15)4-8(9)13(16)17/h3-5H,2H2,1H3.
What are the key properties of 1-ethyl-5,7-dinitroindazole?
1-ethyl-5,7-dinitroindazole has a molecular weight of 236.19 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5,7-dinitroindazole is sourced from PubChem (CID 170170477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).