C12H13N5O7 — CID 71397506
1-ethyl-5-methylimidazole;2,4,6-trinitrophenol (PubChem CID 71397506) has the molecular formula C12H13N5O7 and a molecular weight of 339.26 g/mol. Its IUPAC name is 1-ethyl-5-methylimidazole;2,4,6-trinitrophenol.
| Compound Name | 1-ethyl-5-methylimidazole;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 71397506 |
| Molecular Formula | C12H13N5O7 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-ethyl-5-methylimidazole;2,4,6-trinitrophenol |
| SMILES | CCn1cncc1C.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.C6H10N2/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;1-3-8-5-7-4-6(8)2/h1-2,10H;4-5H,3H2,1-2H3 |
| InChIKey | DEDAIAKMCWFARI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 167.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|