C16H17N7O7 — CID 87588820
1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazin-6-amine;2,4,6-trinitrophenol (PubChem CID 87588820) has the molecular formula C16H17N7O7 and a molecular weight of 419.35 g/mol. Its IUPAC name is 1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazin-6-amine;2,4,6-trinitrophenol.
| Compound Name | 1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazin-6-amine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 87588820 |
| Molecular Formula | C16H17N7O7 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazin-6-amine;2,4,6-trinitrophenol |
| SMILES | Cc1nnc(C)c2c(C)n(N)c(C)c12.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14N4.C6H3N3O7/c1-5-9-7(3)14(11)8(4)10(9)6(2)13-12-5;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h11H2,1-4H3;1-2,10H |
| InChIKey | QJVMPCHRZIZFBI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 206.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|