C23H13F2NO3S — CID 170174510
(2Z)-4,6-difluoro-5,7-dimethyl-2-[(2-phenylthieno[2,3-d][1,3]oxazol-5-yl)methylidene]indene-1,3-dione (PubChem CID 170174510) has the molecular formula C23H13F2NO3S and a molecular weight of 421.42 g/mol. Its IUPAC name is (2Z)-4,6-difluoro-5,7-dimethyl-2-[(2-phenylthieno[2,3-d][1,3]oxazol-5-yl)methylidene]indene-1,3-dione.
| Compound Name | (2Z)-4,6-difluoro-5,7-dimethyl-2-[(2-phenylthieno[2,3-d][1,3]oxazol-5-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 170174510 |
| Molecular Formula | C23H13F2NO3S |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (2Z)-4,6-difluoro-5,7-dimethyl-2-[(2-phenylthieno[2,3-d][1,3]oxazol-5-yl)methylidene]indene-1,3-dione |
| SMILES | Cc1c(F)c(C)c2c(c1F)C(=O)/C(=C\c1cc3oc(-c4ccccc4)nc3s1)C2=O |
| InChI | InChI=1S/C23H13F2NO3S/c1-10-16-17(19(25)11(2)18(10)24)21(28)14(20(16)27)8-13-9-15-23(30-13)26-22(29-15)12-6-4-3-5-7-12/h3-9H,1-2H3/b14-8- |
| InChIKey | ULWMUDSJTVDAAW-ZSOIEALJSA-N |
| XLogP | 5.91 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|