C20H16F5N3O — CID 170178183
6'-(1,1-difluoroethyl)-1'-(2,2,2-trifluoroethylimino)spiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one (PubChem CID 170178183) has the molecular formula C20H16F5N3O and a molecular weight of 409.36 g/mol. Its IUPAC name is 6'-(1,1-difluoroethyl)-1'-(2,2,2-trifluoroethylimino)spiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one.
| Compound Name | 6'-(1,1-difluoroethyl)-1'-(2,2,2-trifluoroethylimino)spiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one |
|---|---|
| PubChem CID | 170178183 |
| Molecular Formula | C20H16F5N3O |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 6'-(1,1-difluoroethyl)-1'-(2,2,2-trifluoroethylimino)spiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one |
| SMILES | CC(F)(F)c1ccc2c(c1)C1(CCc3ncccc31)C(=O)N/C2=N\CC(F)(F)F |
| InChI | InChI=1S/C20H16F5N3O/c1-18(21,22)11-4-5-12-14(9-11)19(7-6-15-13(19)3-2-8-26-15)17(29)28-16(12)27-10-20(23,24)25/h2-5,8-9H,6-7,10H2,1H3,(H,27,28,29) |
| InChIKey | WSMKWBIOSPXJHN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|