C19H19N3O2 — CID 170178566
2'-ethoxy-5'-methyliminospiro[1,2-dihydroindene-3,8'-1,6-naphthyridine]-7'-one (PubChem CID 170178566) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2'-ethoxy-5'-methyliminospiro[1,2-dihydroindene-3,8'-1,6-naphthyridine]-7'-one.
| Compound Name | 2'-ethoxy-5'-methyliminospiro[1,2-dihydroindene-3,8'-1,6-naphthyridine]-7'-one |
|---|---|
| PubChem CID | 170178566 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2'-ethoxy-5'-methyliminospiro[1,2-dihydroindene-3,8'-1,6-naphthyridine]-7'-one |
| SMILES | CCOc1ccc2c(n1)C1(CCc3ccccc31)C(=O)N/C2=N\C |
| InChI | InChI=1S/C19H19N3O2/c1-3-24-15-9-8-13-16(21-15)19(18(23)22-17(13)20-2)11-10-12-6-4-5-7-14(12)19/h4-9H,3,10-11H2,1-2H3,(H,20,22,23) |
| InChIKey | IQWSWOPNHWDPHH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|