C17H13F3N4OS — CID 170178525
5'-sulfanylidene-2'-(2,2,2-trifluoroethylamino)spiro[1,2-dihydroindene-3,8'-pyrido[4,3-d]pyrimidine]-7'-one (PubChem CID 170178525) has the molecular formula C17H13F3N4OS and a molecular weight of 378.38 g/mol. Its IUPAC name is 5'-sulfanylidene-2'-(2,2,2-trifluoroethylamino)spiro[1,2-dihydroindene-3,8'-pyrido[4,3-d]pyrimidine]-7'-one.
| Compound Name | 5'-sulfanylidene-2'-(2,2,2-trifluoroethylamino)spiro[1,2-dihydroindene-3,8'-pyrido[4,3-d]pyrimidine]-7'-one |
|---|---|
| PubChem CID | 170178525 |
| Molecular Formula | C17H13F3N4OS |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 5'-sulfanylidene-2'-(2,2,2-trifluoroethylamino)spiro[1,2-dihydroindene-3,8'-pyrido[4,3-d]pyrimidine]-7'-one |
| SMILES | O=C1NC(=S)c2cnc(NCC(F)(F)F)nc2C12CCc1ccccc12 |
| InChI | InChI=1S/C17H13F3N4OS/c18-17(19,20)8-22-15-21-7-10-12(23-15)16(14(25)24-13(10)26)6-5-9-3-1-2-4-11(9)16/h1-4,7H,5-6,8H2,(H,21,22,23)(H,24,25,26) |
| InChIKey | CISONTXDZHEZJG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|