C16H9F3N2O3 — CID 170178448
2-(trifluoromethyl)spiro[1,6-naphthyridine-8,3'-2H-1-benzofuran]-5,7-dione (PubChem CID 170178448) has the molecular formula C16H9F3N2O3 and a molecular weight of 334.25 g/mol. Its IUPAC name is 2-(trifluoromethyl)spiro[1,6-naphthyridine-8,3'-2H-1-benzofuran]-5,7-dione.
| Compound Name | 2-(trifluoromethyl)spiro[1,6-naphthyridine-8,3'-2H-1-benzofuran]-5,7-dione |
|---|---|
| PubChem CID | 170178448 |
| Molecular Formula | C16H9F3N2O3 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-(trifluoromethyl)spiro[1,6-naphthyridine-8,3'-2H-1-benzofuran]-5,7-dione |
| SMILES | O=C1NC(=O)C2(COc3ccccc32)c2nc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H9F3N2O3/c17-16(18,19)11-6-5-8-12(20-11)15(14(23)21-13(8)22)7-24-10-4-2-1-3-9(10)15/h1-6H,7H2,(H,21,22,23) |
| InChIKey | XXFHGKXBHQFUJK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|