C20H14F2O7S2 — CID 171538181
3,3-bis(4-fluorosulfonyloxyphenyl)-2H-1-benzofuran (PubChem CID 171538181) has the molecular formula C20H14F2O7S2 and a molecular weight of 468.46 g/mol. Its IUPAC name is 3,3-bis(4-fluorosulfonyloxyphenyl)-2H-1-benzofuran.
| Compound Name | 3,3-bis(4-fluorosulfonyloxyphenyl)-2H-1-benzofuran |
|---|---|
| PubChem CID | 171538181 |
| Molecular Formula | C20H14F2O7S2 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 3,3-bis(4-fluorosulfonyloxyphenyl)-2H-1-benzofuran |
| SMILES | O=S(=O)(F)Oc1ccc(C2(c3ccc(OS(=O)(=O)F)cc3)COc3ccccc32)cc1 |
| InChI | InChI=1S/C20H14F2O7S2/c21-30(23,24)28-16-9-5-14(6-10-16)20(13-27-19-4-2-1-3-18(19)20)15-7-11-17(12-8-15)29-31(22,25)26/h1-12H,13H2 |
| InChIKey | UWJRYVHUZAVPRQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |