C16H10F3N3O2 — CID 170178455
2'-(trifluoromethyl)spiro[1,2-dihydroindene-3,8'-pyrido[4,3-d]pyrimidine]-5',7'-dione (PubChem CID 170178455) has the molecular formula C16H10F3N3O2 and a molecular weight of 333.27 g/mol. Its IUPAC name is 2'-(trifluoromethyl)spiro[1,2-dihydroindene-3,8'-pyrido[4,3-d]pyrimidine]-5',7'-dione.
| Compound Name | 2'-(trifluoromethyl)spiro[1,2-dihydroindene-3,8'-pyrido[4,3-d]pyrimidine]-5',7'-dione |
|---|---|
| PubChem CID | 170178455 |
| Molecular Formula | C16H10F3N3O2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2'-(trifluoromethyl)spiro[1,2-dihydroindene-3,8'-pyrido[4,3-d]pyrimidine]-5',7'-dione |
| SMILES | O=C1NC(=O)C2(CCc3ccccc32)c2nc(C(F)(F)F)ncc21 |
| InChI | InChI=1S/C16H10F3N3O2/c17-16(18,19)13-20-7-9-11(21-13)15(14(24)22-12(9)23)6-5-8-3-1-2-4-10(8)15/h1-4,7H,5-6H2,(H,22,23,24) |
| InChIKey | PPTXYNKZOYPJJH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|