C26H33FN4O4S — CID 170178620
2-(6-azaspiro[2.5]octan-6-yl)-N-[6-cyclobutyloxy-5-(fluoromethoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide (PubChem CID 170178620) has the molecular formula C26H33FN4O4S and a molecular weight of 516.64 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[6-cyclobutyloxy-5-(fluoromethoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[6-cyclobutyloxy-5-(fluoromethoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
|---|---|
| PubChem CID | 170178620 |
| Molecular Formula | C26H33FN4O4S |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[6-cyclobutyloxy-5-(fluoromethoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
| SMILES | O=C(Nc1ccc(OCF)c(OC2CCC2)n1)c1ccc(SNCCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C26H33FN4O4S/c27-17-34-22-6-7-23(30-25(22)35-18-2-1-3-18)29-24(33)20-5-4-19(36-28-12-15-32)16-21(20)31-13-10-26(8-9-26)11-14-31/h4-7,16,18,28,32H,1-3,8-15,17H2,(H,29,30,33) |
| InChIKey | SIPWYXMTGSYZOF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|