C23H23Cl3N6 — CID 170181196
1-[C-[1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(methylideneamino)imidazol-4-yl]-N-methylcarbonimidoyl]piperidin-3-amine (PubChem CID 170181196) has the molecular formula C23H23Cl3N6 and a molecular weight of 489.84 g/mol. Its IUPAC name is 1-[C-[1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(methylideneamino)imidazol-4-yl]-N-methylcarbonimidoyl]piperidin-3-amine.
| Compound Name | 1-[C-[1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(methylideneamino)imidazol-4-yl]-N-methylcarbonimidoyl]piperidin-3-amine |
|---|---|
| PubChem CID | 170181196 |
| Molecular Formula | C23H23Cl3N6 |
| Molecular Weight | 489.84 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 1-[C-[1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-5-(methylideneamino)imidazol-4-yl]-N-methylcarbonimidoyl]piperidin-3-amine |
| SMILES | C=Nc1c(/C(=N/C)N2CCCC(N)C2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23Cl3N6/c1-28-22(31-11-3-4-16(27)13-31)20-23(29-2)32(17-8-5-14(24)6-9-17)21(30-20)18-10-7-15(25)12-19(18)26/h5-10,12,16H,2-4,11,13,27H2,1H3/b28-22- |
| InChIKey | CQJCRXQUZLEYEU-SLMZUGIISA-N |
| XLogP | 5.63 |
| TPSA | 71.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.84 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|