C22H21NO4 — CID 170181649
7-[(1S,3Z,5E)-6-hydroxy-2-methylidene-1-pyridin-4-ylhepta-3,5-dienoxy]-2,3-dihydrochromen-4-one (PubChem CID 170181649) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 7-[(1S,3Z,5E)-6-hydroxy-2-methylidene-1-pyridin-4-ylhepta-3,5-dienoxy]-2,3-dihydrochromen-4-one.
| Compound Name | 7-[(1S,3Z,5E)-6-hydroxy-2-methylidene-1-pyridin-4-ylhepta-3,5-dienoxy]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 170181649 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 7-[(1S,3Z,5E)-6-hydroxy-2-methylidene-1-pyridin-4-ylhepta-3,5-dienoxy]-2,3-dihydrochromen-4-one |
| SMILES | C=C(/C=C\C=C(/C)O)[C@H](Oc1ccc2c(c1)OCCC2=O)c1ccncc1 |
| InChI | InChI=1S/C22H21NO4/c1-15(4-3-5-16(2)24)22(17-8-11-23-12-9-17)27-18-6-7-19-20(25)10-13-26-21(19)14-18/h3-9,11-12,14,22,24H,1,10,13H2,2H3/b4-3-,16-5+/t22-/m0/s1 |
| InChIKey | APEYNRSWZAUABV-WRDPSWEXSA-N |
| XLogP | 4.74 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|