C15H29NO4 — CID 170190807
tert-butyl N-[2-(2-ethoxy-2-hydroxy-1-methylcyclopentyl)ethyl]carbamate (PubChem CID 170190807) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is tert-butyl N-[2-(2-ethoxy-2-hydroxy-1-methylcyclopentyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-ethoxy-2-hydroxy-1-methylcyclopentyl)ethyl]carbamate |
|---|---|
| PubChem CID | 170190807 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | tert-butyl N-[2-(2-ethoxy-2-hydroxy-1-methylcyclopentyl)ethyl]carbamate |
| SMILES | CCOC1(O)CCCC1(C)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO4/c1-6-19-15(18)9-7-8-14(15,5)10-11-16-12(17)20-13(2,3)4/h18H,6-11H2,1-5H3,(H,16,17) |
| InChIKey | UPLGABMPCCYLTD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|