C16H24N2O7 — CID 170195190
(2,5-dioxopyrrolidin-1-yl) 3-[2-[1-(2-methylprop-2-enoylamino)propan-2-yloxy]ethoxy]propanoate (PubChem CID 170195190) has the molecular formula C16H24N2O7 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[1-(2-methylprop-2-enoylamino)propan-2-yloxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[1-(2-methylprop-2-enoylamino)propan-2-yloxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 170195190 |
| Molecular Formula | C16H24N2O7 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[1-(2-methylprop-2-enoylamino)propan-2-yloxy]ethoxy]propanoate |
| SMILES | C=C(C)C(=O)NCC(C)OCCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H24N2O7/c1-11(2)16(22)17-10-12(3)24-9-8-23-7-6-15(21)25-18-13(19)4-5-14(18)20/h12H,1,4-10H2,2-3H3,(H,17,22) |
| InChIKey | NNLPXUJDZSXLLY-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|