C30H41N5O7S2 — CID 170197006
methyl 1-[3-(3-hydroxyphenyl)-2-[[3-methyl-2-[3-[2-(pyridin-2-yldisulfanyl)ethoxy]propanoylamino]butanoyl]amino]propanoyl]diazinane-3-carboxylate (PubChem CID 170197006) has the molecular formula C30H41N5O7S2 and a molecular weight of 647.82 g/mol. Its IUPAC name is methyl 1-[3-(3-hydroxyphenyl)-2-[[3-methyl-2-[3-[2-(pyridin-2-yldisulfanyl)ethoxy]propanoylamino]butanoyl]amino]propanoyl]diazinane-3-carboxylate.
| Compound Name | methyl 1-[3-(3-hydroxyphenyl)-2-[[3-methyl-2-[3-[2-(pyridin-2-yldisulfanyl)ethoxy]propanoylamino]butanoyl]amino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 170197006 |
| Molecular Formula | C30H41N5O7S2 |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | methyl 1-[3-(3-hydroxyphenyl)-2-[[3-methyl-2-[3-[2-(pyridin-2-yldisulfanyl)ethoxy]propanoylamino]butanoyl]amino]propanoyl]diazinane-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)C(Cc2cccc(O)c2)NC(=O)C(NC(=O)CCOCCSSc2ccccn2)C(C)C)N1 |
| InChI | InChI=1S/C30H41N5O7S2/c1-20(2)27(33-25(37)12-15-42-16-17-43-44-26-11-4-5-13-31-26)28(38)32-24(19-21-8-6-9-22(36)18-21)29(39)35-14-7-10-23(34-35)30(40)41-3/h4-6,8-9,11,13,18,20,23-24,27,34,36H,7,10,12,14-17,19H2,1-3H3,(H,32,38)(H,33,37) |
| InChIKey | CYRUPKKDHCOVJF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|