C23H45N3O9 — CID 170201169
3-[2-[2-[2-[3-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl-(methyldiazenyl)amino]prop-2-enoxy]ethoxy]ethoxy]ethoxy]propanal (PubChem CID 170201169) has the molecular formula C23H45N3O9 and a molecular weight of 507.63 g/mol. Its IUPAC name is 3-[2-[2-[2-[3-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl-(methyldiazenyl)amino]prop-2-enoxy]ethoxy]ethoxy]ethoxy]propanal.
| Compound Name | 3-[2-[2-[2-[3-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl-(methyldiazenyl)amino]prop-2-enoxy]ethoxy]ethoxy]ethoxy]propanal |
|---|---|
| PubChem CID | 170201169 |
| Molecular Formula | C23H45N3O9 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | 3-[2-[2-[2-[3-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethyl-(methyldiazenyl)amino]prop-2-enoxy]ethoxy]ethoxy]ethoxy]propanal |
| SMILES | CCOCCOCCOCCOCCN(C=CCOCCOCCOCCOCCC=O)/N=N/C |
| InChI | InChI=1S/C23H45N3O9/c1-3-28-12-13-32-20-21-35-19-16-31-11-7-26(25-24-2)6-4-9-29-14-17-33-22-23-34-18-15-30-10-5-8-27/h4,6,8H,3,5,7,9-23H2,1-2H3/b6-4?,25-24+ |
| InChIKey | YGSGERXYMQJZPB-CVZGTRRZSA-N |
| XLogP | 1.54 |
| TPSA | 118.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|