C22H35NO2 — CID 170201297
2-methyl-N-[3-(7-methyl-6-oxodecyl)phenyl]butanamide (PubChem CID 170201297) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 2-methyl-N-[3-(7-methyl-6-oxodecyl)phenyl]butanamide.
| Compound Name | 2-methyl-N-[3-(7-methyl-6-oxodecyl)phenyl]butanamide |
|---|---|
| PubChem CID | 170201297 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | 2-methyl-N-[3-(7-methyl-6-oxodecyl)phenyl]butanamide |
| SMILES | CCCC(C)C(=O)CCCCCc1cccc(NC(=O)C(C)CC)c1 |
| InChI | InChI=1S/C22H35NO2/c1-5-11-18(4)21(24)15-9-7-8-12-19-13-10-14-20(16-19)23-22(25)17(3)6-2/h10,13-14,16-18H,5-9,11-12,15H2,1-4H3,(H,23,25) |
| InChIKey | WTGLYOIXGSOYSE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|