C16H22N4O5 — CID 170202762
[(2R,3S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl butanoate (PubChem CID 170202762) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is [(2R,3S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 170202762 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [(2R,3S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@@]1(C)OCC(O)(c2ccc3c(N)ncnn23)[C@@H]1O |
| InChI | InChI=1S/C16H22N4O5/c1-3-4-12(21)24-7-15(2)14(22)16(23,8-25-15)11-6-5-10-13(17)18-9-19-20(10)11/h5-6,9,14,22-23H,3-4,7-8H2,1-2H3,(H2,17,18,19)/t14-,15-,16?/m1/s1 |
| InChIKey | XECFMOGHDVEXID-YGFGXBMJSA-N |
| XLogP | -0.01 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |