C12H15BrF3N3O — CID 17020414
azepan-1-yl-[4-bromo-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]methanone (PubChem CID 17020414) has the molecular formula C12H15BrF3N3O and a molecular weight of 354.17 g/mol. Its IUPAC name is azepan-1-yl-[4-bromo-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]methanone.
| Compound Name | azepan-1-yl-[4-bromo-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 17020414 |
| Molecular Formula | C12H15BrF3N3O |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | azepan-1-yl-[4-bromo-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]methanone |
| SMILES | Cn1nc(C(F)(F)F)c(Br)c1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H15BrF3N3O/c1-18-9(8(13)10(17-18)12(14,15)16)11(20)19-6-4-2-3-5-7-19/h2-7H2,1H3 |
| InChIKey | UTGPSGKFCPQOFT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |