C10H20N8O3S2 — CID 170208428
6-amino-3-[(3-amino-2-hydroxypropyl)amino]sulfanyl-N'-hydrazinyl-2-sulfamoylbenzenecarboximidamide (PubChem CID 170208428) has the molecular formula C10H20N8O3S2 and a molecular weight of 364.46 g/mol. Its IUPAC name is 6-amino-3-[(3-amino-2-hydroxypropyl)amino]sulfanyl-N'-hydrazinyl-2-sulfamoylbenzenecarboximidamide.
| Compound Name | 6-amino-3-[(3-amino-2-hydroxypropyl)amino]sulfanyl-N'-hydrazinyl-2-sulfamoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 170208428 |
| Molecular Formula | C10H20N8O3S2 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 6-amino-3-[(3-amino-2-hydroxypropyl)amino]sulfanyl-N'-hydrazinyl-2-sulfamoylbenzenecarboximidamide |
| SMILES | NCC(O)CNSc1ccc(N)c(/C(N)=N/NN)c1S(N)(=O)=O |
| InChI | InChI=1S/C10H20N8O3S2/c11-3-5(19)4-16-22-7-2-1-6(12)8(10(13)17-18-14)9(7)23(15,20)21/h1-2,5,16,18-19H,3-4,11-12,14H2,(H2,13,17)(H2,15,20,21) |
| InChIKey | UROIGJUGDQZQSP-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 220.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|