C25H29N3O3 — CID 170210159
[4-[4-[ethoxy(hydroxy)methyl]-2-methylimino-1,3-dihydro-1-benzazepin-7-yl]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 170210159) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is [4-[4-[ethoxy(hydroxy)methyl]-2-methylimino-1,3-dihydro-1-benzazepin-7-yl]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[4-[ethoxy(hydroxy)methyl]-2-methylimino-1,3-dihydro-1-benzazepin-7-yl]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 170210159 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [4-[4-[ethoxy(hydroxy)methyl]-2-methylimino-1,3-dihydro-1-benzazepin-7-yl]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | CCOC(O)C1=Cc2cc(-c3ccc(C(=O)N4CCCC4)cc3)ccc2N/C(=N/C)C1 |
| InChI | InChI=1S/C25H29N3O3/c1-3-31-25(30)21-15-20-14-19(10-11-22(20)27-23(16-21)26-2)17-6-8-18(9-7-17)24(29)28-12-4-5-13-28/h6-11,14-15,25,30H,3-5,12-13,16H2,1-2H3,(H,26,27) |
| InChIKey | XYTQIYCXELRDLY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|