C23H33ClN4OS — CID 170212440
N'-[4-[[(4-chlorophenyl)methyl-methylamino]sulfanyl-(dimethylamino)methoxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 170212440) has the molecular formula C23H33ClN4OS and a molecular weight of 449.06 g/mol. Its IUPAC name is N'-[4-[[(4-chlorophenyl)methyl-methylamino]sulfanyl-(dimethylamino)methoxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[[(4-chlorophenyl)methyl-methylamino]sulfanyl-(dimethylamino)methoxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 170212440 |
| Molecular Formula | C23H33ClN4OS |
| Molecular Weight | 449.06 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N'-[4-[[(4-chlorophenyl)methyl-methylamino]sulfanyl-(dimethylamino)methoxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(OC(SN(C)Cc2ccc(Cl)cc2)N(C)C)cc1C |
| InChI | InChI=1S/C23H33ClN4OS/c1-8-27(6)16-25-21-13-18(3)22(14-17(21)2)29-23(26(4)5)30-28(7)15-19-9-11-20(24)12-10-19/h9-14,16,23H,8,15H2,1-7H3/b25-16+ |
| InChIKey | UUSRODHSLANHEM-PCLIKHOPSA-N |
| XLogP | 5.57 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.06 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|