C20H20Cl2N4OS — CID 58214396
N'-[5-chloro-4-[[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 58214396) has the molecular formula C20H20Cl2N4OS and a molecular weight of 435.38 g/mol. Its IUPAC name is N'-[5-chloro-4-[[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[5-chloro-4-[[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 58214396 |
| Molecular Formula | C20H20Cl2N4OS |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | N'-[5-chloro-4-[[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Cl)c(Oc2nc(Cc3ccc(Cl)cc3)ns2)cc1C |
| InChI | InChI=1S/C20H20Cl2N4OS/c1-4-26(3)12-23-17-11-16(22)18(9-13(17)2)27-20-24-19(25-28-20)10-14-5-7-15(21)8-6-14/h5-9,11-12H,4,10H2,1-3H3/b23-12+ |
| InChIKey | HWHKANWHVGKGPE-FSJBWODESA-N |
| XLogP | 6.15 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|