C22H25ClN4OS — CID 58214423
N'-[4-[[3-[1-(4-chlorophenyl)ethyl]-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 58214423) has the molecular formula C22H25ClN4OS and a molecular weight of 428.99 g/mol. Its IUPAC name is N'-[4-[[3-[1-(4-chlorophenyl)ethyl]-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[[3-[1-(4-chlorophenyl)ethyl]-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 58214423 |
| Molecular Formula | C22H25ClN4OS |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N'-[4-[[3-[1-(4-chlorophenyl)ethyl]-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2nc(C(C)c3ccc(Cl)cc3)ns2)cc1C |
| InChI | InChI=1S/C22H25ClN4OS/c1-6-27(5)13-24-19-11-15(3)20(12-14(19)2)28-22-25-21(26-29-22)16(4)17-7-9-18(23)10-8-17/h7-13,16H,6H2,1-5H3/b24-13+ |
| InChIKey | GQPYIFADGLDQMJ-ZMOGYAJESA-N |
| XLogP | 6.36 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|