C11H6ClFN2O3 — CID 170213760
N-(3-chloro-4-fluorophenyl)-2-formyl-1,3-oxazole-4-carboxamide (PubChem CID 170213760) has the molecular formula C11H6ClFN2O3 and a molecular weight of 268.63 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-formyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-formyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 170213760 |
| Molecular Formula | C11H6ClFN2O3 |
| Molecular Weight | 268.63 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-formyl-1,3-oxazole-4-carboxamide |
| SMILES | O=Cc1nc(C(=O)Nc2ccc(F)c(Cl)c2)co1 |
| InChI | InChI=1S/C11H6ClFN2O3/c12-7-3-6(1-2-8(7)13)14-11(17)9-5-18-10(4-16)15-9/h1-5H,(H,14,17) |
| InChIKey | CVGASULGXUTUSC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|