C10H5ClFN3O3 — CID 58941813
N-(3-chloro-4-fluorophenyl)-4-formyl-1,2,5-oxadiazole-3-carboxamide (PubChem CID 58941813) has the molecular formula C10H5ClFN3O3 and a molecular weight of 269.62 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-formyl-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-formyl-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 58941813 |
| Molecular Formula | C10H5ClFN3O3 |
| Molecular Weight | 269.62 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-formyl-1,2,5-oxadiazole-3-carboxamide |
| SMILES | O=Cc1nonc1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H5ClFN3O3/c11-6-3-5(1-2-7(6)12)13-10(17)9-8(4-16)14-18-15-9/h1-4H,(H,13,17) |
| InChIKey | CQJFDEHBHAEGCU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|