C59H43N7 — CID 170214845
3-[2,4-bis[3-[4-(3,4-dimethylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]benzonitrile (PubChem CID 170214845) has the molecular formula C59H43N7 and a molecular weight of 850.04 g/mol. Its IUPAC name is 3-[2,4-bis[3-[4-(3,4-dimethylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]benzonitrile.
| Compound Name | 3-[2,4-bis[3-[4-(3,4-dimethylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 170214845 |
| Molecular Formula | C59H43N7 |
| Molecular Weight | 850.04 g/mol |
| Exact Mass | 849.36 |
| IUPAC Name | 3-[2,4-bis[3-[4-(3,4-dimethylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]benzonitrile |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc(-c5cccc(C#N)c5)c(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccc(C)c(C)c7)n6)c5)c4)c3)n2)cc1C |
| InChI | InChI=1S/C59H43N7/c1-37-24-26-50(30-39(37)3)58-63-54(42-15-7-5-8-16-42)61-56(65-58)48-22-12-19-44(33-48)45-28-29-52(46-20-11-14-41(32-46)36-60)53(35-45)47-21-13-23-49(34-47)57-62-55(43-17-9-6-10-18-43)64-59(66-57)51-27-25-38(2)40(4)31-51/h5-35H,1-4H3 |
| InChIKey | HKMWJHZVGWEKBS-UHFFFAOYSA-N |
| XLogP | 14.16 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.04 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |