C55H35N7 — CID 170214920
3-[3,4-bis[3-(5,6-diphenyl-1,2,4-triazin-3-yl)phenyl]phenyl]benzonitrile (PubChem CID 170214920) has the molecular formula C55H35N7 and a molecular weight of 793.93 g/mol. Its IUPAC name is 3-[3,4-bis[3-(5,6-diphenyl-1,2,4-triazin-3-yl)phenyl]phenyl]benzonitrile.
| Compound Name | 3-[3,4-bis[3-(5,6-diphenyl-1,2,4-triazin-3-yl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 170214920 |
| Molecular Formula | C55H35N7 |
| Molecular Weight | 793.93 g/mol |
| Exact Mass | 793.30 |
| IUPAC Name | 3-[3,4-bis[3-(5,6-diphenyl-1,2,4-triazin-3-yl)phenyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(-c3cccc(-c4nnc(-c5ccccc5)c(-c5ccccc5)n4)c3)c(-c3cccc(-c4nnc(-c5ccccc5)c(-c5ccccc5)n4)c3)c2)c1 |
| InChI | InChI=1S/C55H35N7/c56-36-37-16-13-25-42(32-37)43-30-31-48(44-26-14-28-46(33-44)54-57-50(38-17-5-1-6-18-38)52(59-61-54)40-21-9-3-10-22-40)49(35-43)45-27-15-29-47(34-45)55-58-51(39-19-7-2-8-20-39)53(60-62-55)41-23-11-4-12-24-41/h1-35H |
| InChIKey | DZFLSVFTLAXTIU-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.93 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |