C22H17ClFN5OS — CID 17021728
N-(1-benzyl-4-chloropyrazol-3-yl)-2-[4-(4-fluorophenyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 17021728) has the molecular formula C22H17ClFN5OS and a molecular weight of 453.93 g/mol. Its IUPAC name is N-(1-benzyl-4-chloropyrazol-3-yl)-2-[4-(4-fluorophenyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(1-benzyl-4-chloropyrazol-3-yl)-2-[4-(4-fluorophenyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 17021728 |
| Molecular Formula | C22H17ClFN5OS |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | N-(1-benzyl-4-chloropyrazol-3-yl)-2-[4-(4-fluorophenyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nccc(-c2ccc(F)cc2)n1)Nc1nn(Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H17ClFN5OS/c23-18-13-29(12-15-4-2-1-3-5-15)28-21(18)27-20(30)14-31-22-25-11-10-19(26-22)16-6-8-17(24)9-7-16/h1-11,13H,12,14H2,(H,27,28,30) |
| InChIKey | XHOHXFOBOCMJIW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |