C14H9ClF7N3O — CID 19400722
N-(1-benzyl-4-chloropyrazol-3-yl)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 19400722) has the molecular formula C14H9ClF7N3O and a molecular weight of 403.69 g/mol. Its IUPAC name is N-(1-benzyl-4-chloropyrazol-3-yl)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-(1-benzyl-4-chloropyrazol-3-yl)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 19400722 |
| Molecular Formula | C14H9ClF7N3O |
| Molecular Weight | 403.69 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | N-(1-benzyl-4-chloropyrazol-3-yl)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(Nc1nn(Cc2ccccc2)cc1Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H9ClF7N3O/c15-9-7-25(6-8-4-2-1-3-5-8)24-10(9)23-11(26)12(16,17)13(18,19)14(20,21)22/h1-5,7H,6H2,(H,23,24,26) |
| InChIKey | JIGVVLIYYZKBFL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|