C11H21NO2S — CID 170221923
3-(1,1-dioxo-4-propylthiolan-3-yl)-N-methylpropan-1-imine (PubChem CID 170221923) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 3-(1,1-dioxo-4-propylthiolan-3-yl)-N-methylpropan-1-imine.
| Compound Name | 3-(1,1-dioxo-4-propylthiolan-3-yl)-N-methylpropan-1-imine |
|---|---|
| PubChem CID | 170221923 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 3-(1,1-dioxo-4-propylthiolan-3-yl)-N-methylpropan-1-imine |
| SMILES | CCCC1CS(=O)(=O)CC1CC/C=N/C |
| InChI | InChI=1S/C11H21NO2S/c1-3-5-10-8-15(13,14)9-11(10)6-4-7-12-2/h7,10-11H,3-6,8-9H2,1-2H3/b12-7+ |
| InChIKey | BXKXXZCDFSLBKN-KPKJPENVSA-N |
| XLogP | 1.93 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|