C19H17ClFN5O4 — CID 170224385
3-chloro-4-fluoro-2-hydroxy-5-[6-[2-(methylamino)-2-oxoethyl]-2-oxo-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl]benzamide (PubChem CID 170224385) has the molecular formula C19H17ClFN5O4 and a molecular weight of 433.83 g/mol. Its IUPAC name is 3-chloro-4-fluoro-2-hydroxy-5-[6-[2-(methylamino)-2-oxoethyl]-2-oxo-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl]benzamide.
| Compound Name | 3-chloro-4-fluoro-2-hydroxy-5-[6-[2-(methylamino)-2-oxoethyl]-2-oxo-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl]benzamide |
|---|---|
| PubChem CID | 170224385 |
| Molecular Formula | C19H17ClFN5O4 |
| Molecular Weight | 433.83 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 3-chloro-4-fluoro-2-hydroxy-5-[6-[2-(methylamino)-2-oxoethyl]-2-oxo-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-4-yl]benzamide |
| SMILES | CNC(=O)Cn1cc(-c2cc(C(N)=O)c(O)c(Cl)c2F)c2c(=O)n3c(nc21)CCC3 |
| InChI | InChI=1S/C19H17ClFN5O4/c1-23-12(27)7-25-6-10(8-5-9(17(22)29)16(28)14(20)15(8)21)13-18(25)24-11-3-2-4-26(11)19(13)30/h5-6,28H,2-4,7H2,1H3,(H2,22,29)(H,23,27) |
| InChIKey | CZVCMHJXADTCIJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.83 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |