C29H28ClFN6O7 — CID 170224554
N-(3-chloro-2-fluoro-6-morpholin-4-yl-4-pyridinyl)-2-[4-(5-formyl-4-hydroxy-2,3-dimethoxyphenyl)-2-oxo-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-6-yl]acetamide (PubChem CID 170224554) has the molecular formula C29H28ClFN6O7 and a molecular weight of 627.03 g/mol. Its IUPAC name is N-(3-chloro-2-fluoro-6-morpholin-4-yl-4-pyridinyl)-2-[4-(5-formyl-4-hydroxy-2,3-dimethoxyphenyl)-2-oxo-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-6-yl]acetamide.
| Compound Name | N-(3-chloro-2-fluoro-6-morpholin-4-yl-4-pyridinyl)-2-[4-(5-formyl-4-hydroxy-2,3-dimethoxyphenyl)-2-oxo-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-6-yl]acetamide |
|---|---|
| PubChem CID | 170224554 |
| Molecular Formula | C29H28ClFN6O7 |
| Molecular Weight | 627.03 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | N-(3-chloro-2-fluoro-6-morpholin-4-yl-4-pyridinyl)-2-[4-(5-formyl-4-hydroxy-2,3-dimethoxyphenyl)-2-oxo-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-6-yl]acetamide |
| SMILES | COc1c(-c2cn(CC(=O)Nc3cc(N4CCOCC4)nc(F)c3Cl)c3nc4n(c(=O)c23)CCC4)cc(C=O)c(O)c1OC |
| InChI | InChI=1S/C29H28ClFN6O7/c1-42-25-16(10-15(14-38)24(40)26(25)43-2)17-12-36(28-22(17)29(41)37-5-3-4-19(37)34-28)13-21(39)32-18-11-20(33-27(31)23(18)30)35-6-8-44-9-7-35/h10-12,14,40H,3-9,13H2,1-2H3,(H,32,33,39) |
| InChIKey | XMVGNXRPHCCPAX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.03 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|