C17H34N2O4S — CID 170226185
(4S)-6-[3-(1-amino-3-oxobutoxy)-2-hydroxypropyl]sulfanyl-2-methyl-4-(propan-2-ylamino)hexan-3-one (PubChem CID 170226185) has the molecular formula C17H34N2O4S and a molecular weight of 362.54 g/mol. Its IUPAC name is (4S)-6-[3-(1-amino-3-oxobutoxy)-2-hydroxypropyl]sulfanyl-2-methyl-4-(propan-2-ylamino)hexan-3-one.
| Compound Name | (4S)-6-[3-(1-amino-3-oxobutoxy)-2-hydroxypropyl]sulfanyl-2-methyl-4-(propan-2-ylamino)hexan-3-one |
|---|---|
| PubChem CID | 170226185 |
| Molecular Formula | C17H34N2O4S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (4S)-6-[3-(1-amino-3-oxobutoxy)-2-hydroxypropyl]sulfanyl-2-methyl-4-(propan-2-ylamino)hexan-3-one |
| SMILES | CC(=O)CC(N)OCC(O)CSCC[C@H](NC(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C17H34N2O4S/c1-11(2)17(22)15(19-12(3)4)6-7-24-10-14(21)9-23-16(18)8-13(5)20/h11-12,14-16,19,21H,6-10,18H2,1-5H3/t14?,15-,16?/m0/s1 |
| InChIKey | VZJHLLUFPFMZFE-PCKAHOCUSA-N |
| XLogP | 1.34 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|