C50H35N3O2 — CID 170231123
2-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-4-(7-naphtho[2,1-b][1]benzofuran-9-yl-3,4-dihydrodibenzofuran-1-yl)-6-phenyl-1,3,5-triazine (PubChem CID 170231123) has the molecular formula C50H35N3O2 and a molecular weight of 709.85 g/mol. Its IUPAC name is 2-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-4-(7-naphtho[2,1-b][1]benzofuran-9-yl-3,4-dihydrodibenzofuran-1-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-4-(7-naphtho[2,1-b][1]benzofuran-9-yl-3,4-dihydrodibenzofuran-1-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 170231123 |
| Molecular Formula | C50H35N3O2 |
| Molecular Weight | 709.85 g/mol |
| Exact Mass | 709.27 |
| IUPAC Name | 2-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-4-(7-naphtho[2,1-b][1]benzofuran-9-yl-3,4-dihydrodibenzofuran-1-yl)-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C\C=C/Cc1ccc(-c2nc(C3=CCCc4oc5cc(-c6ccc7c(c6)oc6ccc8ccccc8c67)ccc5c43)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C50H35N3O2/c1-2-3-4-5-7-13-32-20-22-35(23-21-32)49-51-48(34-15-8-6-9-16-34)52-50(53-49)41-18-12-19-42-47(41)40-28-25-37(31-45(40)54-42)36-24-27-39-44(30-36)55-43-29-26-33-14-10-11-17-38(33)46(39)43/h2-11,14-18,20-31H,1,12-13,19H2/b4-3-,7-5- |
| InChIKey | QEMRKSAIBRWDFV-MRWCJKGFSA-N |
| XLogP | 12.89 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.85 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|