C35H52F2N6O — CID 170233690
4,4-difluoro-N-[(1S)-3-[(3S)-3-[[4-(methylamino)butyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]piperazin-1-yl]-1-phenylpropyl]cyclohexane-1-carboxamide (PubChem CID 170233690) has the molecular formula C35H52F2N6O and a molecular weight of 610.84 g/mol. Its IUPAC name is 4,4-difluoro-N-[(1S)-3-[(3S)-3-[[4-(methylamino)butyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]piperazin-1-yl]-1-phenylpropyl]cyclohexane-1-carboxamide.
| Compound Name | 4,4-difluoro-N-[(1S)-3-[(3S)-3-[[4-(methylamino)butyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]piperazin-1-yl]-1-phenylpropyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 170233690 |
| Molecular Formula | C35H52F2N6O |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.42 |
| IUPAC Name | 4,4-difluoro-N-[(1S)-3-[(3S)-3-[[4-(methylamino)butyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]piperazin-1-yl]-1-phenylpropyl]cyclohexane-1-carboxamide |
| SMILES | CNCCCCN(C[C@@H]1CN(CC[C@H](NC(=O)C2CCC(F)(F)CC2)c2ccccc2)CCN1)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C35H52F2N6O/c1-38-19-5-6-22-43(32-13-7-11-28-12-8-20-40-33(28)32)26-30-25-42(24-21-39-30)23-16-31(27-9-3-2-4-10-27)41-34(44)29-14-17-35(36,37)18-15-29/h2-4,8-10,12,20,29-32,38-39H,5-7,11,13-19,21-26H2,1H3,(H,41,44)/t30-,31-,32-/m0/s1 |
| InChIKey | VDXPGSPXCNGHHX-CPCREDONSA-N |
| XLogP | 5.11 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|