C16H14N4 — CID 170235177
1,3-diphenylpyrazole-5-carboximidamide (PubChem CID 170235177) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is 1,3-diphenylpyrazole-5-carboximidamide.
| Compound Name | 1,3-diphenylpyrazole-5-carboximidamide |
|---|---|
| PubChem CID | 170235177 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1,3-diphenylpyrazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C16H14N4/c17-16(18)15-11-14(12-7-3-1-4-8-12)19-20(15)13-9-5-2-6-10-13/h1-11H,(H3,17,18) |
| InChIKey | PVVLJZFAOXSPFD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|