C17H13N2O+ — CID 170235916
9,12-dimethyl-18-oxa-4-aza-9-azoniapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-1(17),2,5(10),6,8,11,13,15-octaene (PubChem CID 170235916) has the molecular formula C17H13N2O+ and a molecular weight of 261.30 g/mol. Its IUPAC name is 9,12-dimethyl-18-oxa-4-aza-9-azoniapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-1(17),2,5(10),6,8,11,13,15-octaene.
| Compound Name | 9,12-dimethyl-18-oxa-4-aza-9-azoniapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-1(17),2,5(10),6,8,11,13,15-octaene |
|---|---|
| PubChem CID | 170235916 |
| Molecular Formula | C17H13N2O+ |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 9,12-dimethyl-18-oxa-4-aza-9-azoniapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-1(17),2,5(10),6,8,11,13,15-octaene |
| SMILES | Cc1ccc2oc3ccn4c5ccc[n+](C)c5c1c2c34 |
| InChI | InChI=1S/C17H13N2O/c1-10-5-6-12-15-14(10)16-11(4-3-8-18(16)2)19-9-7-13(20-12)17(15)19/h3-9H,1-2H3/q+1 |
| InChIKey | YPBHJYIMQDGCJC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|