C23H28O7 — CID 170238232
[(1S,2S,4S,5R,7S,8R,9R,11S)-1-methyl-17-oxo-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl] hexanoate (PubChem CID 170238232) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is [(1S,2S,4S,5R,7S,8R,9R,11S)-1-methyl-17-oxo-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl] hexanoate.
| Compound Name | [(1S,2S,4S,5R,7S,8R,9R,11S)-1-methyl-17-oxo-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl] hexanoate |
|---|---|
| PubChem CID | 170238232 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [(1S,2S,4S,5R,7S,8R,9R,11S)-1-methyl-17-oxo-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1[C@H]2O[C@H]2[C@@H]2O[C@]23[C@]12O[C@H]2CC1C2=C(CC[C@@]13C)C(=O)OC2 |
| InChI | InChI=1S/C23H28O7/c1-3-4-5-6-15(24)27-18-16-17(28-16)19-23(30-19)21(2)8-7-11-12(10-26-20(11)25)13(21)9-14-22(18,23)29-14/h13-14,16-19H,3-10H2,1-2H3/t13?,14-,16-,17+,18+,19-,21-,22+,23+/m0/s1 |
| InChIKey | QGUJUZOJUDZMKV-PCDJUGDCSA-N |
| XLogP | 2.21 |
| TPSA | 90.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|