C24H30O8 — CID 162736993
4-[(1-methyl-16-oxo-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadec-13(17)-en-7-yl)oxy]-4-oxobutanoic acid (PubChem CID 162736993) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is 4-[(1-methyl-16-oxo-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadec-13(17)-en-7-yl)oxy]-4-oxobutanoic acid.
| Compound Name | 4-[(1-methyl-16-oxo-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadec-13(17)-en-7-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 162736993 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-[(1-methyl-16-oxo-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadec-13(17)-en-7-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(C)C1CC2OC23C2(C)CCC4=C(COC4=O)C2CC2OC23C1OC(=O)CCC(=O)O |
| InChI | InChI=1S/C24H30O8/c1-11(2)13-8-17-24(32-17)22(3)7-6-12-14(10-29-21(12)28)15(22)9-16-23(24,31-16)20(13)30-19(27)5-4-18(25)26/h11,13,15-17,20H,4-10H2,1-3H3,(H,25,26) |
| InChIKey | LMHVDTFJNYFCOX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|