C24H30O9 — CID 170240297
4-[[(1R,2R,3S,5S,7R,8S)-7-hydroxy-8-methyl-12-oxo-3-propan-2-yl-4,13,18-trioxahexacyclo[15.1.1.01,7.03,5.08,16.011,15]nonadec-11(15)-en-2-yl]oxy]-4-oxobutanoic acid (PubChem CID 170240297) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is 4-[[(1R,2R,3S,5S,7R,8S)-7-hydroxy-8-methyl-12-oxo-3-propan-2-yl-4,13,18-trioxahexacyclo[15.1.1.01,7.03,5.08,16.011,15]nonadec-11(15)-en-2-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(1R,2R,3S,5S,7R,8S)-7-hydroxy-8-methyl-12-oxo-3-propan-2-yl-4,13,18-trioxahexacyclo[15.1.1.01,7.03,5.08,16.011,15]nonadec-11(15)-en-2-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 170240297 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 4-[[(1R,2R,3S,5S,7R,8S)-7-hydroxy-8-methyl-12-oxo-3-propan-2-yl-4,13,18-trioxahexacyclo[15.1.1.01,7.03,5.08,16.011,15]nonadec-11(15)-en-2-yl]oxy]-4-oxobutanoic acid |
| SMILES | CC(C)[C@]12O[C@H]1C[C@@]1(O)[C@@]3(C)CCC4=C(COC4=O)C3C3C[C@@]1(O3)[C@@H]2OC(=O)CCC(=O)O |
| InChI | InChI=1S/C24H30O9/c1-11(2)24-15(33-24)9-23(29)21(3)7-6-12-13(10-30-19(12)28)18(21)14-8-22(23,32-14)20(24)31-17(27)5-4-16(25)26/h11,14-15,18,20,29H,4-10H2,1-3H3,(H,25,26)/t14?,15-,18?,20-,21-,22+,23+,24-/m0/s1 |
| InChIKey | BTLBSNPHGSKPOL-OPAYRMPDSA-N |
| XLogP | 1.50 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|