C22H30O6S — CID 91234171
4-hydroxy-8-methyl-2-(methylsulfanylmethoxy)-3-propan-2-yl-6,13,18-trioxahexacyclo[15.1.1.01,7.05,7.08,16.011,15]nonadec-11(15)-en-12-one (PubChem CID 91234171) has the molecular formula C22H30O6S and a molecular weight of 422.54 g/mol. Its IUPAC name is 4-hydroxy-8-methyl-2-(methylsulfanylmethoxy)-3-propan-2-yl-6,13,18-trioxahexacyclo[15.1.1.01,7.05,7.08,16.011,15]nonadec-11(15)-en-12-one.
| Compound Name | 4-hydroxy-8-methyl-2-(methylsulfanylmethoxy)-3-propan-2-yl-6,13,18-trioxahexacyclo[15.1.1.01,7.05,7.08,16.011,15]nonadec-11(15)-en-12-one |
|---|---|
| PubChem CID | 91234171 |
| Molecular Formula | C22H30O6S |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 4-hydroxy-8-methyl-2-(methylsulfanylmethoxy)-3-propan-2-yl-6,13,18-trioxahexacyclo[15.1.1.01,7.05,7.08,16.011,15]nonadec-11(15)-en-12-one |
| SMILES | CSCOC1C(C(C)C)C(O)C2OC23C2(C)CCC4=C(COC4=O)C2C2CC13O2 |
| InChI | InChI=1S/C22H30O6S/c1-10(2)14-16(23)18-22(28-18)20(3)6-5-11-12(8-25-19(11)24)15(20)13-7-21(22,27-13)17(14)26-9-29-4/h10,13-18,23H,5-9H2,1-4H3 |
| InChIKey | YDAYNSFJFLAJDR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|