C30H33ClN2O8S — CID 170241949
methyl (3S)-3-[[4-[[3-chloro-4-(2-methoxyethoxy)phenyl]sulfonyl-(2-methoxy-2-oxoethyl)amino]naphthalen-1-yl]-prop-2-ynylamino]butanoate (PubChem CID 170241949) has the molecular formula C30H33ClN2O8S and a molecular weight of 617.12 g/mol. Its IUPAC name is methyl (3S)-3-[[4-[[3-chloro-4-(2-methoxyethoxy)phenyl]sulfonyl-(2-methoxy-2-oxoethyl)amino]naphthalen-1-yl]-prop-2-ynylamino]butanoate.
| Compound Name | methyl (3S)-3-[[4-[[3-chloro-4-(2-methoxyethoxy)phenyl]sulfonyl-(2-methoxy-2-oxoethyl)amino]naphthalen-1-yl]-prop-2-ynylamino]butanoate |
|---|---|
| PubChem CID | 170241949 |
| Molecular Formula | C30H33ClN2O8S |
| Molecular Weight | 617.12 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | methyl (3S)-3-[[4-[[3-chloro-4-(2-methoxyethoxy)phenyl]sulfonyl-(2-methoxy-2-oxoethyl)amino]naphthalen-1-yl]-prop-2-ynylamino]butanoate |
| SMILES | C#CCN(c1ccc(N(CC(=O)OC)S(=O)(=O)c2ccc(OCCOC)c(Cl)c2)c2ccccc12)[C@@H](C)CC(=O)OC |
| InChI | InChI=1S/C30H33ClN2O8S/c1-6-15-32(21(2)18-29(34)39-4)26-12-13-27(24-10-8-7-9-23(24)26)33(20-30(35)40-5)42(36,37)22-11-14-28(25(31)19-22)41-17-16-38-3/h1,7-14,19,21H,15-18,20H2,2-5H3/t21-/m0/s1 |
| InChIKey | BTLHMWAOGZWFHR-NRFANRHFSA-N |
| XLogP | 4.28 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.12 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|