C21H19ClN4O2 — CID 170242354
2-[[(E)-[(Z)-1-(4-chlorophenyl)but-2-enylidene]amino]-formylamino]-N-(1H-indol-5-yl)acetamide (PubChem CID 170242354) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-[[(E)-[(Z)-1-(4-chlorophenyl)but-2-enylidene]amino]-formylamino]-N-(1H-indol-5-yl)acetamide.
| Compound Name | 2-[[(E)-[(Z)-1-(4-chlorophenyl)but-2-enylidene]amino]-formylamino]-N-(1H-indol-5-yl)acetamide |
|---|---|
| PubChem CID | 170242354 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[[(E)-[(Z)-1-(4-chlorophenyl)but-2-enylidene]amino]-formylamino]-N-(1H-indol-5-yl)acetamide |
| SMILES | C/C=C\C(=N/N(C=O)CC(=O)Nc1ccc2[nH]ccc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN4O2/c1-2-3-20(15-4-6-17(22)7-5-15)25-26(14-27)13-21(28)24-18-8-9-19-16(12-18)10-11-23-19/h2-12,14,23H,13H2,1H3,(H,24,28)/b3-2-,25-20+ |
| InChIKey | RIDUHVZZTAYIKD-ZNCNMFBMSA-N |
| XLogP | 4.20 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|