C22H20ClN3O — CID 71706434
3-(4-chlorophenyl)-N-(1H-indol-5-yl)-4-pyrrol-1-ylbutanamide (PubChem CID 71706434) has the molecular formula C22H20ClN3O and a molecular weight of 377.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(1H-indol-5-yl)-4-pyrrol-1-ylbutanamide.
| Compound Name | 3-(4-chlorophenyl)-N-(1H-indol-5-yl)-4-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 71706434 |
| Molecular Formula | C22H20ClN3O |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(1H-indol-5-yl)-4-pyrrol-1-ylbutanamide |
| SMILES | O=C(CC(Cn1cccc1)c1ccc(Cl)cc1)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C22H20ClN3O/c23-19-5-3-16(4-6-19)18(15-26-11-1-2-12-26)14-22(27)25-20-7-8-21-17(13-20)9-10-24-21/h1-13,18,24H,14-15H2,(H,25,27) |
| InChIKey | PIEHQRZOTSUCPV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |