C18H14F3N3O5 — CID 17024236
[5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone (PubChem CID 17024236) has the molecular formula C18H14F3N3O5 and a molecular weight of 409.32 g/mol. Its IUPAC name is [5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone.
| Compound Name | [5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 17024236 |
| Molecular Formula | C18H14F3N3O5 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-[3-[(4-nitrophenoxy)methyl]phenyl]methanone |
| SMILES | O=C(c1cccc(COc2ccc([N+](=O)[O-])cc2)c1)N1N=CCC1(O)C(F)(F)F |
| InChI | InChI=1S/C18H14F3N3O5/c19-18(20,21)17(26)8-9-22-23(17)16(25)13-3-1-2-12(10-13)11-29-15-6-4-14(5-7-15)24(27)28/h1-7,9-10,26H,8,11H2 |
| InChIKey | MZGGONGSBZQBMF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|